C29H37Cl2N5O4 — CID 167376875
tert-butyl (3S)-4-[6,7-dichloro-1-[2,6-di(propan-2-yl)phenyl]-8-oxido-2-oxopyrido[2,3-d]pyrimidin-8-ium-4-yl]-3-methylpiperazine-1-carboxylate (PubChem CID 167376875) has the molecular formula C29H37Cl2N5O4 and a molecular weight of 590.55 g/mol. Its IUPAC name is tert-butyl (3S)-4-[6,7-dichloro-1-[2,6-di(propan-2-yl)phenyl]-8-oxido-2-oxopyrido[2,3-d]pyrimidin-8-ium-4-yl]-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-4-[6,7-dichloro-1-[2,6-di(propan-2-yl)phenyl]-8-oxido-2-oxopyrido[2,3-d]pyrimidin-8-ium-4-yl]-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 167376875 |
| Molecular Formula | C29H37Cl2N5O4 |
| Molecular Weight | 590.55 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | tert-butyl (3S)-4-[6,7-dichloro-1-[2,6-di(propan-2-yl)phenyl]-8-oxido-2-oxopyrido[2,3-d]pyrimidin-8-ium-4-yl]-3-methylpiperazine-1-carboxylate |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1c(=O)nc(N2CCN(C(=O)OC(C)(C)C)C[C@@H]2C)c2cc(Cl)c(Cl)[n+]([O-])c21 |
| InChI | InChI=1S/C29H37Cl2N5O4/c1-16(2)19-10-9-11-20(17(3)4)23(19)35-26-21(14-22(30)24(31)36(26)39)25(32-27(35)37)34-13-12-33(15-18(34)5)28(38)40-29(6,7)8/h9-11,14,16-18H,12-13,15H2,1-8H3/t18-/m0/s1 |
| InChIKey | XTXCRDOPEHYXDW-SFHVURJKSA-N |
| XLogP | 6.02 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.55 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|