C19H18Cl2FN3O — CID 167376878
4,7-dichloro-1-[2,6-di(propan-2-yl)phenyl]-6-fluoropyrido[2,3-d]pyrimidin-2-one (PubChem CID 167376878) has the molecular formula C19H18Cl2FN3O and a molecular weight of 394.28 g/mol. Its IUPAC name is 4,7-dichloro-1-[2,6-di(propan-2-yl)phenyl]-6-fluoropyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 4,7-dichloro-1-[2,6-di(propan-2-yl)phenyl]-6-fluoropyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 167376878 |
| Molecular Formula | C19H18Cl2FN3O |
| Molecular Weight | 394.28 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 4,7-dichloro-1-[2,6-di(propan-2-yl)phenyl]-6-fluoropyrido[2,3-d]pyrimidin-2-one |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1c(=O)nc(Cl)c2cc(F)c(Cl)nc21 |
| InChI | InChI=1S/C19H18Cl2FN3O/c1-9(2)11-6-5-7-12(10(3)4)15(11)25-18-13(16(20)24-19(25)26)8-14(22)17(21)23-18/h5-10H,1-4H3 |
| InChIKey | URWDADLMFRISFM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.28 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|