C19H18Cl2FN3O2 — CID 167376922
4,7-dichloro-1-[2,6-di(propan-2-yl)phenyl]-6-fluoro-8-oxidopyrido[2,3-d]pyrimidin-8-ium-2-one (PubChem CID 167376922) has the molecular formula C19H18Cl2FN3O2 and a molecular weight of 410.28 g/mol. Its IUPAC name is 4,7-dichloro-1-[2,6-di(propan-2-yl)phenyl]-6-fluoro-8-oxidopyrido[2,3-d]pyrimidin-8-ium-2-one.
| Compound Name | 4,7-dichloro-1-[2,6-di(propan-2-yl)phenyl]-6-fluoro-8-oxidopyrido[2,3-d]pyrimidin-8-ium-2-one |
|---|---|
| PubChem CID | 167376922 |
| Molecular Formula | C19H18Cl2FN3O2 |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 4,7-dichloro-1-[2,6-di(propan-2-yl)phenyl]-6-fluoro-8-oxidopyrido[2,3-d]pyrimidin-8-ium-2-one |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1c(=O)nc(Cl)c2cc(F)c(Cl)[n+]([O-])c21 |
| InChI | InChI=1S/C19H18Cl2FN3O2/c1-9(2)11-6-5-7-12(10(3)4)15(11)24-18-13(16(20)23-19(24)26)8-14(22)17(21)25(18)27/h5-10H,1-4H3 |
| InChIKey | APJUICTVRLWSQR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|