C13H17N3O3S — CID 167377021
2-tert-butyl-N-(2,6-dioxopiperidin-3-yl)-1,3-thiazole-5-carboxamide (PubChem CID 167377021) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is 2-tert-butyl-N-(2,6-dioxopiperidin-3-yl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-tert-butyl-N-(2,6-dioxopiperidin-3-yl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 167377021 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-tert-butyl-N-(2,6-dioxopiperidin-3-yl)-1,3-thiazole-5-carboxamide |
| SMILES | CC(C)(C)c1ncc(C(=O)NC2CCC(=O)NC2=O)s1 |
| InChI | InChI=1S/C13H17N3O3S/c1-13(2,3)12-14-6-8(20-12)11(19)15-7-4-5-9(17)16-10(7)18/h6-7H,4-5H2,1-3H3,(H,15,19)(H,16,17,18) |
| InChIKey | NKZYRUKMCHOGHP-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|