C34H43N3O7S — CID 167377607
N-[(1R)-1-(4-ethylsulfonylphenyl)-2-hydroxyethyl]-4-[(3R)-3-[4-(3-morpholin-4-ylpropoxy)phenoxy]pyrrolidin-1-yl]benzamide (PubChem CID 167377607) has the molecular formula C34H43N3O7S and a molecular weight of 637.80 g/mol. Its IUPAC name is N-[(1R)-1-(4-ethylsulfonylphenyl)-2-hydroxyethyl]-4-[(3R)-3-[4-(3-morpholin-4-ylpropoxy)phenoxy]pyrrolidin-1-yl]benzamide.
| Compound Name | N-[(1R)-1-(4-ethylsulfonylphenyl)-2-hydroxyethyl]-4-[(3R)-3-[4-(3-morpholin-4-ylpropoxy)phenoxy]pyrrolidin-1-yl]benzamide |
|---|---|
| PubChem CID | 167377607 |
| Molecular Formula | C34H43N3O7S |
| Molecular Weight | 637.80 g/mol |
| Exact Mass | 637.28 |
| IUPAC Name | N-[(1R)-1-(4-ethylsulfonylphenyl)-2-hydroxyethyl]-4-[(3R)-3-[4-(3-morpholin-4-ylpropoxy)phenoxy]pyrrolidin-1-yl]benzamide |
| SMILES | CCS(=O)(=O)c1ccc([C@H](CO)NC(=O)c2ccc(N3CC[C@@H](Oc4ccc(OCCCN5CCOCC5)cc4)C3)cc2)cc1 |
| InChI | InChI=1S/C34H43N3O7S/c1-2-45(40,41)32-14-6-26(7-15-32)33(25-38)35-34(39)27-4-8-28(9-5-27)37-18-16-31(24-37)44-30-12-10-29(11-13-30)43-21-3-17-36-19-22-42-23-20-36/h4-15,31,33,38H,2-3,16-25H2,1H3,(H,35,39)/t31-,33+/m1/s1 |
| InChIKey | MVVKJGFGOSYUHG-VTIYRKAUSA-N |
| XLogP | 3.70 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.80 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|