C13H8FN5OS — CID 16737801
6-(2-fluoro-4-pyridinyl)-3-(2-methylfuran-3-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 16737801) has the molecular formula C13H8FN5OS and a molecular weight of 301.31 g/mol. Its IUPAC name is 6-(2-fluoro-4-pyridinyl)-3-(2-methylfuran-3-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-(2-fluoro-4-pyridinyl)-3-(2-methylfuran-3-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 16737801 |
| Molecular Formula | C13H8FN5OS |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 6-(2-fluoro-4-pyridinyl)-3-(2-methylfuran-3-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Cc1occc1-c1nnc2sc(-c3ccnc(F)c3)nn12 |
| InChI | InChI=1S/C13H8FN5OS/c1-7-9(3-5-20-7)11-16-17-13-19(11)18-12(21-13)8-2-4-15-10(14)6-8/h2-6H,1H3 |
| InChIKey | NPJGRCINCDLSDQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 69.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|