C28H46O7 — CID 16737815
[(2S,3R,4S,5S,6R)-2-[[(1S,4S,4aR,8aS)-1,6-dimethyl-4-[(2R)-6-methylhept-5-en-2-yl]-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-yl]oxy]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] acetate (PubChem CID 16737815) has the molecular formula C28H46O7 and a molecular weight of 494.67 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-2-[[(1S,4S,4aR,8aS)-1,6-dimethyl-4-[(2R)-6-methylhept-5-en-2-yl]-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-yl]oxy]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] acetate.
| Compound Name | [(2S,3R,4S,5S,6R)-2-[[(1S,4S,4aR,8aS)-1,6-dimethyl-4-[(2R)-6-methylhept-5-en-2-yl]-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-yl]oxy]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 16737815 |
| Molecular Formula | C28H46O7 |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.32 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-2-[[(1S,4S,4aR,8aS)-1,6-dimethyl-4-[(2R)-6-methylhept-5-en-2-yl]-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-yl]oxy]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](O)[C@@H](CO)O[C@@H](O[C@@]2(C)CC[C@@H]([C@H](C)CCC=C(C)C)[C@@H]3C=C(C)CC[C@@H]32)[C@@H]1O |
| InChI | InChI=1S/C28H46O7/c1-16(2)8-7-9-18(4)20-12-13-28(6,22-11-10-17(3)14-21(20)22)35-27-25(32)26(33-19(5)30)24(31)23(15-29)34-27/h8,14,18,20-27,29,31-32H,7,9-13,15H2,1-6H3/t18-,20+,21+,22+,23-,24+,25-,26+,27+,28+/m1/s1 |
| InChIKey | XTAQJIXEGQHTGP-LOCPLYNGSA-N |
| XLogP | 3.90 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|