About 4-methylfuro[2,3-b]furan
4-methylfuro[2,3-b]furan (PubChem CID 167378516) has the molecular formula C7H6O2
and a molecular weight of 122.12 g/mol. Its IUPAC name is 4-methylfuro[2,3-b]furan.
Molecular Properties
| Compound Name | 4-methylfuro[2,3-b]furan |
|---|
| PubChem CID | 167378516 |
|---|
| Molecular Formula | C7H6O2 |
|---|
| Molecular Weight | 122.12 g/mol |
|---|
| Exact Mass | 122.04 |
|---|
| IUPAC Name | 4-methylfuro[2,3-b]furan |
|---|
| SMILES | Cc1coc2occc12 |
|---|
| InChI | InChI=1S/C7H6O2/c1-5-4-9-7-6(5)2-3-8-7/h2-4H,1H3 |
|---|
| InChIKey | JTTKJELKNWFHDU-UHFFFAOYSA-N |
|---|
| XLogP | 2.33 |
|---|
| TPSA | 26.28 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 2 |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 9 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 122.12 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylfuro[2,3-b]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylfuro[2,3-b]furan?
The IUPAC name of 4-methylfuro[2,3-b]furan (CID 167378516) is 4-methylfuro[2,3-b]furan.
What is the SMILES notation for 4-methylfuro[2,3-b]furan?
The canonical SMILES for 4-methylfuro[2,3-b]furan is Cc1coc2occc12.
What is the InChIKey of 4-methylfuro[2,3-b]furan?
The InChIKey is JTTKJELKNWFHDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2/c1-5-4-9-7-6(5)2-3-8-7/h2-4H,1H3.
What are the key properties of 4-methylfuro[2,3-b]furan?
4-methylfuro[2,3-b]furan has a molecular weight of 122.12 g/mol, XLogP of 2.33, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylfuro[2,3-b]furan is sourced from PubChem (CID 167378516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).