About 3,6-ditert-butyl-7-methyl-2H-pyrazolo[4,3-c]pyridine
3,6-ditert-butyl-7-methyl-2H-pyrazolo[4,3-c]pyridine (PubChem CID 167379586) has the molecular formula C15H23N3
and a molecular weight of 245.37 g/mol. Its IUPAC name is 3,6-ditert-butyl-7-methyl-2H-pyrazolo[4,3-c]pyridine.
Molecular Properties
| Compound Name | 3,6-ditert-butyl-7-methyl-2H-pyrazolo[4,3-c]pyridine |
| PubChem CID | 167379586 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 3,6-ditert-butyl-7-methyl-2H-pyrazolo[4,3-c]pyridine |
| SMILES | Cc1c(C(C)(C)C)ncc2c(C(C)(C)C)[nH]nc12 |
| InChI | InChI=1S/C15H23N3/c1-9-11-10(8-16-12(9)14(2,3)4)13(18-17-11)15(5,6)7/h8H,1-7H3,(H,17,18) |
| InChIKey | OXXDLZAKMPCMEU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,6-ditert-butyl-7-methyl-2H-pyrazolo[4,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-ditert-butyl-7-methyl-2H-pyrazolo[4,3-c]pyridine?
The IUPAC name of 3,6-ditert-butyl-7-methyl-2H-pyrazolo[4,3-c]pyridine (CID 167379586) is 3,6-ditert-butyl-7-methyl-2H-pyrazolo[4,3-c]pyridine.
What is the SMILES notation for 3,6-ditert-butyl-7-methyl-2H-pyrazolo[4,3-c]pyridine?
The canonical SMILES for 3,6-ditert-butyl-7-methyl-2H-pyrazolo[4,3-c]pyridine is Cc1c(C(C)(C)C)ncc2c(C(C)(C)C)[nH]nc12.
What is the InChIKey of 3,6-ditert-butyl-7-methyl-2H-pyrazolo[4,3-c]pyridine?
The InChIKey is OXXDLZAKMPCMEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3/c1-9-11-10(8-16-12(9)14(2,3)4)13(18-17-11)15(5,6)7/h8H,1-7H3,(H,17,18).
What are the key properties of 3,6-ditert-butyl-7-methyl-2H-pyrazolo[4,3-c]pyridine?
3,6-ditert-butyl-7-methyl-2H-pyrazolo[4,3-c]pyridine has a molecular weight of 245.37 g/mol, XLogP of 3.86, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-ditert-butyl-7-methyl-2H-pyrazolo[4,3-c]pyridine is sourced from PubChem (CID 167379586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).