C14H15BF3NO4 — CID 167379743
5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-3-(1,1,2-trifluoroethyl)-1,3-benzoxazol-2-one (PubChem CID 167379743) has the molecular formula C14H15BF3NO4 and a molecular weight of 329.08 g/mol. Its IUPAC name is 5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-3-(1,1,2-trifluoroethyl)-1,3-benzoxazol-2-one.
| Compound Name | 5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-3-(1,1,2-trifluoroethyl)-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 167379743 |
| Molecular Formula | C14H15BF3NO4 |
| Molecular Weight | 329.08 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-3-(1,1,2-trifluoroethyl)-1,3-benzoxazol-2-one |
| SMILES | CC1(C)COB(c2ccc3oc(=O)n(C(F)(F)CF)c3c2)OC1 |
| InChI | InChI=1S/C14H15BF3NO4/c1-13(2)7-21-15(22-8-13)9-3-4-11-10(5-9)19(12(20)23-11)14(17,18)6-16/h3-5H,6-8H2,1-2H3 |
| InChIKey | JZLJVOKYGGGNLO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 53.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.08 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|