About dimethyl (3-methyl-4-nitrophenyl) phosphate
dimethyl (3-methyl-4-nitrophenyl) phosphate (PubChem CID 16738) has the molecular formula C9H12NO6P
and a molecular weight of 261.17 g/mol. Its IUPAC name is dimethyl (3-methyl-4-nitrophenyl) phosphate.
Molecular Properties
| Compound Name | dimethyl (3-methyl-4-nitrophenyl) phosphate |
| PubChem CID | 16738 |
| Molecular Formula | C9H12NO6P |
| Molecular Weight | 261.17 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | dimethyl (3-methyl-4-nitrophenyl) phosphate |
| SMILES | COP(=O)(OC)Oc1ccc([N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C9H12NO6P/c1-7-6-8(4-5-9(7)10(11)12)16-17(13,14-2)15-3/h4-6H,1-3H3 |
| InChIKey | MJNAIAPNXYJWCT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.17 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (3-methyl-4-nitrophenyl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (3-methyl-4-nitrophenyl) phosphate?
The IUPAC name of dimethyl (3-methyl-4-nitrophenyl) phosphate (CID 16738) is dimethyl (3-methyl-4-nitrophenyl) phosphate.
What is the SMILES notation for dimethyl (3-methyl-4-nitrophenyl) phosphate?
The canonical SMILES for dimethyl (3-methyl-4-nitrophenyl) phosphate is COP(=O)(OC)Oc1ccc([N+](=O)[O-])c(C)c1.
What is the InChIKey of dimethyl (3-methyl-4-nitrophenyl) phosphate?
The InChIKey is MJNAIAPNXYJWCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12NO6P/c1-7-6-8(4-5-9(7)10(11)12)16-17(13,14-2)15-3/h4-6H,1-3H3.
What are the key properties of dimethyl (3-methyl-4-nitrophenyl) phosphate?
dimethyl (3-methyl-4-nitrophenyl) phosphate has a molecular weight of 261.17 g/mol, XLogP of 2.68, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (3-methyl-4-nitrophenyl) phosphate is sourced from PubChem (CID 16738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).