C33H32F3N7O3 — CID 167380975
9-[7-[8-(difluoromethyl)naphthalen-1-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-1,3,9-triazaspiro[4.5]decane-2,4-dione (PubChem CID 167380975) has the molecular formula C33H32F3N7O3 and a molecular weight of 631.66 g/mol. Its IUPAC name is 9-[7-[8-(difluoromethyl)naphthalen-1-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-1,3,9-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 9-[7-[8-(difluoromethyl)naphthalen-1-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-1,3,9-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 167380975 |
| Molecular Formula | C33H32F3N7O3 |
| Molecular Weight | 631.66 g/mol |
| Exact Mass | 631.25 |
| IUPAC Name | 9-[7-[8-(difluoromethyl)naphthalen-1-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-1,3,9-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCCN(c3nc(OCC45CCCN4CCC5)nc4c(F)c(-c5cccc6cccc(C(F)F)c56)ncc34)C2)N1 |
| InChI | InChI=1S/C33H32F3N7O3/c34-24-25(20-8-1-6-19-7-2-9-21(23(19)20)27(35)36)37-16-22-26(24)38-31(46-18-32-10-3-14-43(32)15-4-11-32)39-28(22)42-13-5-12-33(17-42)29(44)40-30(45)41-33/h1-2,6-9,16,27H,3-5,10-15,17-18H2,(H2,40,41,44,45) |
| InChIKey | ITWXAMQLHAZFEA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 112.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.66 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|