C73H49N5 — CID 167381341
2-[3-[3-[3-[4,6-bis(4-phenylphenyl)pyrimidin-2-yl]phenyl]phenyl]phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine (PubChem CID 167381341) has the molecular formula C73H49N5 and a molecular weight of 996.23 g/mol. Its IUPAC name is 2-[3-[3-[3-[4,6-bis(4-phenylphenyl)pyrimidin-2-yl]phenyl]phenyl]phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[3-[3-[3-[4,6-bis(4-phenylphenyl)pyrimidin-2-yl]phenyl]phenyl]phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 167381341 |
| Molecular Formula | C73H49N5 |
| Molecular Weight | 996.23 g/mol |
| Exact Mass | 995.40 |
| IUPAC Name | 2-[3-[3-[3-[4,6-bis(4-phenylphenyl)pyrimidin-2-yl]phenyl]phenyl]phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc(-c3cc(-c4ccc(-c5ccccc5)cc4)nc(-c4cccc(-c5cccc(-c6cccc(-c7nc(-c8ccc(-c9ccccc9)cc8)nc(-c8ccc(-c9ccccc9)cc8)n7)c6)c5)c4)n3)cc2)cc1 |
| InChI | InChI=1S/C73H49N5/c1-5-16-50(17-6-1)54-30-38-58(39-31-54)68-49-69(59-40-32-55(33-41-59)51-18-7-2-8-19-51)75-72(74-68)66-28-14-26-64(47-66)62-24-13-25-63(46-62)65-27-15-29-67(48-65)73-77-70(60-42-34-56(35-43-60)52-20-9-3-10-21-52)76-71(78-73)61-44-36-57(37-45-61)53-22-11-4-12-23-53/h1-49H |
| InChIKey | VEBGWYACHBWRSB-UHFFFAOYSA-N |
| XLogP | 18.67 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 996.23 |
| LogP ≤ 5 | 18.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |