C51H25N5O2 — CID 167381379
3-([1]benzofuro[3,2-b]carbazol-11-yl)-2-[4-([1]benzofuro[3,2-b]carbazol-11-yl)-3-cyanophenyl]-4-isocyanobenzonitrile (PubChem CID 167381379) has the molecular formula C51H25N5O2 and a molecular weight of 739.79 g/mol. Its IUPAC name is 3-([1]benzofuro[3,2-b]carbazol-11-yl)-2-[4-([1]benzofuro[3,2-b]carbazol-11-yl)-3-cyanophenyl]-4-isocyanobenzonitrile.
| Compound Name | 3-([1]benzofuro[3,2-b]carbazol-11-yl)-2-[4-([1]benzofuro[3,2-b]carbazol-11-yl)-3-cyanophenyl]-4-isocyanobenzonitrile |
|---|---|
| PubChem CID | 167381379 |
| Molecular Formula | C51H25N5O2 |
| Molecular Weight | 739.79 g/mol |
| Exact Mass | 739.20 |
| IUPAC Name | 3-([1]benzofuro[3,2-b]carbazol-11-yl)-2-[4-([1]benzofuro[3,2-b]carbazol-11-yl)-3-cyanophenyl]-4-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1ccc(C#N)c(-c2ccc(-n3c4ccccc4c4cc5oc6ccccc6c5cc43)c(C#N)c2)c1-n1c2ccccc2c2cc3oc4ccccc4c3cc21 |
| InChI | InChI=1S/C51H25N5O2/c1-54-40-20-18-30(27-52)50(51(40)56-43-15-7-3-11-33(43)37-26-49-39(24-45(37)56)35-13-5-9-17-47(35)58-49)29-19-21-41(31(22-29)28-53)55-42-14-6-2-10-32(42)36-25-48-38(23-44(36)55)34-12-4-8-16-46(34)57-48/h2-26H |
| InChIKey | SCMGKBVEGHRFJO-UHFFFAOYSA-N |
| XLogP | 13.64 |
| TPSA | 88.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.79 |
| LogP ≤ 5 | 13.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|