About 9-(5-bromo-2-nitrophenyl)-3,6-ditert-butylcarbazole
9-(5-bromo-2-nitrophenyl)-3,6-ditert-butylcarbazole (PubChem CID 167381688) has the molecular formula C26H27BrN2O2
and a molecular weight of 479.42 g/mol. Its IUPAC name is 9-(5-bromo-2-nitrophenyl)-3,6-ditert-butylcarbazole.
Molecular Properties
| Compound Name | 9-(5-bromo-2-nitrophenyl)-3,6-ditert-butylcarbazole |
| PubChem CID | 167381688 |
| Molecular Formula | C26H27BrN2O2 |
| Molecular Weight | 479.42 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 9-(5-bromo-2-nitrophenyl)-3,6-ditert-butylcarbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1cc(Br)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H27BrN2O2/c1-25(2,3)16-7-10-21-19(13-16)20-14-17(26(4,5)6)8-11-22(20)28(21)24-15-18(27)9-12-23(24)29(30)31/h7-15H,1-6H3 |
| InChIKey | YICZLXBWENLBRC-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.42 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-(5-bromo-2-nitrophenyl)-3,6-ditert-butylcarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(5-bromo-2-nitrophenyl)-3,6-ditert-butylcarbazole?
The IUPAC name of 9-(5-bromo-2-nitrophenyl)-3,6-ditert-butylcarbazole (CID 167381688) is 9-(5-bromo-2-nitrophenyl)-3,6-ditert-butylcarbazole.
What is the SMILES notation for 9-(5-bromo-2-nitrophenyl)-3,6-ditert-butylcarbazole?
The canonical SMILES for 9-(5-bromo-2-nitrophenyl)-3,6-ditert-butylcarbazole is CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1cc(Br)ccc1[N+](=O)[O-].
What is the InChIKey of 9-(5-bromo-2-nitrophenyl)-3,6-ditert-butylcarbazole?
The InChIKey is YICZLXBWENLBRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27BrN2O2/c1-25(2,3)16-7-10-21-19(13-16)20-14-17(26(4,5)6)8-11-22(20)28(21)24-15-18(27)9-12-23(24)29(30)31/h7-15H,1-6H3.
What are the key properties of 9-(5-bromo-2-nitrophenyl)-3,6-ditert-butylcarbazole?
9-(5-bromo-2-nitrophenyl)-3,6-ditert-butylcarbazole has a molecular weight of 479.42 g/mol, XLogP of 8.05, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(5-bromo-2-nitrophenyl)-3,6-ditert-butylcarbazole is sourced from PubChem (CID 167381688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).