C47H44BN4Pt-3 — CID 167381883
[9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]-[3-[3-(2,3,4,5,6-pentamethylphenyl)-2H-imidazol-2-id-1-yl]benzene-2-id-1-yl]-phenylborane;platinum (PubChem CID 167381883) has the molecular formula C47H44BN4Pt-3 and a molecular weight of 870.79 g/mol. Its IUPAC name is [9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]-[3-[3-(2,3,4,5,6-pentamethylphenyl)-2H-imidazol-2-id-1-yl]benzene-2-id-1-yl]-phenylborane;platinum.
| Compound Name | [9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]-[3-[3-(2,3,4,5,6-pentamethylphenyl)-2H-imidazol-2-id-1-yl]benzene-2-id-1-yl]-phenylborane;platinum |
|---|---|
| PubChem CID | 167381883 |
| Molecular Formula | C47H44BN4Pt-3 |
| Molecular Weight | 870.79 g/mol |
| Exact Mass | 870.33 |
| IUPAC Name | [9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]-[3-[3-(2,3,4,5,6-pentamethylphenyl)-2H-imidazol-2-id-1-yl]benzene-2-id-1-yl]-phenylborane;platinum |
| SMILES | Cc1c(C)c(C)c(N2C=CN(c3[c-]c(B(c4[c-]c5c(cc4)c4ccccc4n5-c4cc(C(C)(C)C)ccn4)c4ccccc4)ccc3)[CH-]2)c(C)c1C.[Pt] |
| InChI | InChI=1S/C47H44BN4.Pt/c1-31-32(2)34(4)46(35(5)33(31)3)51-26-25-50(30-51)40-18-14-17-38(28-40)48(37-15-10-9-11-16-37)39-21-22-42-41-19-12-13-20-43(41)52(44(42)29-39)45-27-36(23-24-49-45)47(6,7)8;/h9-27,30H,1-8H3;/q-3; |
| InChIKey | FOCKTYZZVKLSDB-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.79 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|