About trans-(1S,2S)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclohexan-1-ol
trans-(1S,2S)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclohexan-1-ol (PubChem CID 16738223) has the molecular formula C13H23NO3
and a molecular weight of 241.33 g/mol. Its IUPAC name is trans-(1S,2S)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclohexan-1-ol.
Molecular Properties
| Compound Name | trans-(1S,2S)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclohexan-1-ol |
| PubChem CID | 16738223 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | trans-(1S,2S)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclohexan-1-ol |
| SMILES | O[C@H]1CCCC[C@@H]1N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C13H23NO3/c15-12-4-2-1-3-11(12)14-7-5-13(6-8-14)16-9-10-17-13/h11-12,15H,1-10H2/t11-,12-/m0/s1 |
| InChIKey | IWLMQUZBTRWHER-RYUDHWBXSA-N |
| XLogP | 1.13 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze trans-(1S,2S)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2S)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclohexan-1-ol?
The IUPAC name of trans-(1S,2S)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclohexan-1-ol (CID 16738223) is trans-(1S,2S)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclohexan-1-ol.
What is the SMILES notation for trans-(1S,2S)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclohexan-1-ol?
The canonical SMILES for trans-(1S,2S)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclohexan-1-ol is O[C@H]1CCCC[C@@H]1N1CCC2(CC1)OCCO2.
What is the InChIKey of trans-(1S,2S)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclohexan-1-ol?
The InChIKey is IWLMQUZBTRWHER-RYUDHWBXSA-N. The full InChI is InChI=1S/C13H23NO3/c15-12-4-2-1-3-11(12)14-7-5-13(6-8-14)16-9-10-17-13/h11-12,15H,1-10H2/t11-,12-/m0/s1.
What are the key properties of trans-(1S,2S)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclohexan-1-ol?
trans-(1S,2S)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclohexan-1-ol has a molecular weight of 241.33 g/mol, XLogP of 1.13, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2S)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclohexan-1-ol is sourced from PubChem (CID 16738223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).