C53H49N4OPt- — CID 167382274
CID 167382274 (PubChem CID 167382274) has the molecular formula C53H49N4OPt- and a molecular weight of 953.08 g/mol.
| Compound Name | CID 167382274 |
|---|---|
| PubChem CID | 167382274 |
| Molecular Formula | C53H49N4OPt- |
| Molecular Weight | 953.08 g/mol |
| Exact Mass | 952.36 |
| IUPAC Name | — |
| SMILES | CC(C)c1ccccc1-c1cc(Oc2[c-]c3c(cc2)c2ccccc2n3-c2cc(C(C)(C)C)ccn2)[c-]c([N+]23[CH-][N@+]2(c2cccc(C(C)(C)C)c2)c2ccccc23)c1.[Pt] |
| InChI | InChI=1S/C53H49N4O.Pt/c1-35(2)43-18-9-10-19-44(43)36-28-40(57-34-56(57,49-22-13-14-23-50(49)57)39-17-15-16-37(30-39)52(3,4)5)32-42(29-36)58-41-24-25-46-45-20-11-12-21-47(45)55(48(46)33-41)51-31-38(26-27-54-51)53(6,7)8;/h9-31,34-35H,1-8H3;/q-1;/t56-,57?;/m0./s1 |
| InChIKey | LJQVLJZUPLCJTO-RHQQSDBSSA-N |
| XLogP | 14.29 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 953.08 |
| LogP ≤ 5 | 14.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|