About 4-[(1S,2S)-2-[2-(4-bromophenoxy)ethoxy]cyclohexyl]morpholine
4-[(1S,2S)-2-[2-(4-bromophenoxy)ethoxy]cyclohexyl]morpholine (PubChem CID 16738236) has the molecular formula C18H26BrNO3
and a molecular weight of 384.31 g/mol. Its IUPAC name is 4-[(1S,2S)-2-[2-(4-bromophenoxy)ethoxy]cyclohexyl]morpholine.
Molecular Properties
| Compound Name | 4-[(1S,2S)-2-[2-(4-bromophenoxy)ethoxy]cyclohexyl]morpholine |
| PubChem CID | 16738236 |
| Molecular Formula | C18H26BrNO3 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 4-[(1S,2S)-2-[2-(4-bromophenoxy)ethoxy]cyclohexyl]morpholine |
| SMILES | Brc1ccc(OCCO[C@H]2CCCC[C@@H]2N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H26BrNO3/c19-15-5-7-16(8-6-15)22-13-14-23-18-4-2-1-3-17(18)20-9-11-21-12-10-20/h5-8,17-18H,1-4,9-14H2/t17-,18-/m0/s1 |
| InChIKey | ZRKQIHYNSZCMGE-ROUUACIJSA-N |
| XLogP | 3.49 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1S,2S)-2-[2-(4-bromophenoxy)ethoxy]cyclohexyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1S,2S)-2-[2-(4-bromophenoxy)ethoxy]cyclohexyl]morpholine?
The IUPAC name of 4-[(1S,2S)-2-[2-(4-bromophenoxy)ethoxy]cyclohexyl]morpholine (CID 16738236) is 4-[(1S,2S)-2-[2-(4-bromophenoxy)ethoxy]cyclohexyl]morpholine.
What is the SMILES notation for 4-[(1S,2S)-2-[2-(4-bromophenoxy)ethoxy]cyclohexyl]morpholine?
The canonical SMILES for 4-[(1S,2S)-2-[2-(4-bromophenoxy)ethoxy]cyclohexyl]morpholine is Brc1ccc(OCCO[C@H]2CCCC[C@@H]2N2CCOCC2)cc1.
What is the InChIKey of 4-[(1S,2S)-2-[2-(4-bromophenoxy)ethoxy]cyclohexyl]morpholine?
The InChIKey is ZRKQIHYNSZCMGE-ROUUACIJSA-N. The full InChI is InChI=1S/C18H26BrNO3/c19-15-5-7-16(8-6-15)22-13-14-23-18-4-2-1-3-17(18)20-9-11-21-12-10-20/h5-8,17-18H,1-4,9-14H2/t17-,18-/m0/s1.
What are the key properties of 4-[(1S,2S)-2-[2-(4-bromophenoxy)ethoxy]cyclohexyl]morpholine?
4-[(1S,2S)-2-[2-(4-bromophenoxy)ethoxy]cyclohexyl]morpholine has a molecular weight of 384.31 g/mol, XLogP of 3.49, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1S,2S)-2-[2-(4-bromophenoxy)ethoxy]cyclohexyl]morpholine is sourced from PubChem (CID 16738236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).