C48H33N5Pt — CID 167382684
N-phenyl-N-[3-(3-phenyl-2H-benzimidazol-1-yl)benzene-2-id-1-yl]-9-(4-phenyl-2-pyridinyl)-1H-carbazol-1-id-2-amine;platinum(2+) (PubChem CID 167382684) has the molecular formula C48H33N5Pt and a molecular weight of 874.91 g/mol. Its IUPAC name is N-phenyl-N-[3-(3-phenyl-2H-benzimidazol-1-yl)benzene-2-id-1-yl]-9-(4-phenyl-2-pyridinyl)-1H-carbazol-1-id-2-amine;platinum(2+).
| Compound Name | N-phenyl-N-[3-(3-phenyl-2H-benzimidazol-1-yl)benzene-2-id-1-yl]-9-(4-phenyl-2-pyridinyl)-1H-carbazol-1-id-2-amine;platinum(2+) |
|---|---|
| PubChem CID | 167382684 |
| Molecular Formula | C48H33N5Pt |
| Molecular Weight | 874.91 g/mol |
| Exact Mass | 874.24 |
| IUPAC Name | N-phenyl-N-[3-(3-phenyl-2H-benzimidazol-1-yl)benzene-2-id-1-yl]-9-(4-phenyl-2-pyridinyl)-1H-carbazol-1-id-2-amine;platinum(2+) |
| SMILES | [Pt+2].[c-]1c(N2CN(c3ccccc3)c3ccccc32)cccc1N(c1[c-]c2c(cc1)c1ccccc1n2-c1cc(-c2ccccc2)ccn1)c1ccccc1 |
| InChI | InChI=1S/C48H33N5.Pt/c1-4-15-35(16-5-1)36-29-30-49-48(31-36)53-44-24-11-10-23-42(44)43-28-27-41(33-47(43)53)52(38-19-8-3-9-20-38)40-22-14-21-39(32-40)51-34-50(37-17-6-2-7-18-37)45-25-12-13-26-46(45)51;/h1-31H,34H2;/q-2;+2 |
| InChIKey | IUHWFHRPFZOJEI-UHFFFAOYSA-N |
| XLogP | 12.16 |
| TPSA | 27.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.91 |
| LogP ≤ 5 | 12.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|