C23H40N2 — CID 167384464
(2E,4Z)-1-N-[(2Z,4Z)-3,4-ditert-butylhexa-2,4-dienyl]-3-N-prop-2-enylhexa-2,4-diene-1,3-diamine (PubChem CID 167384464) has the molecular formula C23H40N2 and a molecular weight of 344.59 g/mol. Its IUPAC name is (2E,4Z)-1-N-[(2Z,4Z)-3,4-ditert-butylhexa-2,4-dienyl]-3-N-prop-2-enylhexa-2,4-diene-1,3-diamine.
| Compound Name | (2E,4Z)-1-N-[(2Z,4Z)-3,4-ditert-butylhexa-2,4-dienyl]-3-N-prop-2-enylhexa-2,4-diene-1,3-diamine |
|---|---|
| PubChem CID | 167384464 |
| Molecular Formula | C23H40N2 |
| Molecular Weight | 344.59 g/mol |
| Exact Mass | 344.32 |
| IUPAC Name | (2E,4Z)-1-N-[(2Z,4Z)-3,4-ditert-butylhexa-2,4-dienyl]-3-N-prop-2-enylhexa-2,4-diene-1,3-diamine |
| SMILES | C=CCNC(/C=C\C)=C/CNC/C=C(C(=C/C)\C(C)(C)C)/C(C)(C)C |
| InChI | InChI=1S/C23H40N2/c1-10-13-19(25-16-11-2)14-17-24-18-15-21(23(7,8)9)20(12-3)22(4,5)6/h10-15,24-25H,2,16-18H2,1,3-9H3/b13-10-,19-14+,20-12+,21-15+ |
| InChIKey | QUIBCVZWJQOTMZ-LJSZPEMZSA-N |
| XLogP | 5.78 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.59 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|