C29H48N2 — CID 167384468
(2E,4Z)-1-N-[(1E)-3,4-ditert-butylhexa-1,5-dienyl]-3-N-[(3E,5E)-7-methylocta-1,3,5-trien-3-yl]hexa-2,4-diene-1,3-diamine (PubChem CID 167384468) has the molecular formula C29H48N2 and a molecular weight of 424.72 g/mol. Its IUPAC name is (2E,4Z)-1-N-[(1E)-3,4-ditert-butylhexa-1,5-dienyl]-3-N-[(3E,5E)-7-methylocta-1,3,5-trien-3-yl]hexa-2,4-diene-1,3-diamine.
| Compound Name | (2E,4Z)-1-N-[(1E)-3,4-ditert-butylhexa-1,5-dienyl]-3-N-[(3E,5E)-7-methylocta-1,3,5-trien-3-yl]hexa-2,4-diene-1,3-diamine |
|---|---|
| PubChem CID | 167384468 |
| Molecular Formula | C29H48N2 |
| Molecular Weight | 424.72 g/mol |
| Exact Mass | 424.38 |
| IUPAC Name | (2E,4Z)-1-N-[(1E)-3,4-ditert-butylhexa-1,5-dienyl]-3-N-[(3E,5E)-7-methylocta-1,3,5-trien-3-yl]hexa-2,4-diene-1,3-diamine |
| SMILES | C=C/C(=C\C=C\C(C)C)NC(/C=C\C)=C/CN/C=C/C(C(C=C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C29H48N2/c1-12-16-25(31-24(13-2)18-15-17-23(4)5)19-21-30-22-20-27(29(9,10)11)26(14-3)28(6,7)8/h12-20,22-23,26-27,30-31H,2-3,21H2,1,4-11H3/b16-12-,17-15+,22-20+,24-18+,25-19+ |
| InChIKey | RKSDQTGVQRQFNA-FJNHOCKXSA-N |
| XLogP | 7.93 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.72 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|