C63H94BN2S — CID 167384733
CID 167384733 (PubChem CID 167384733) has the molecular formula C63H94BN2S and a molecular weight of 922.34 g/mol.
| Compound Name | CID 167384733 |
|---|---|
| PubChem CID | 167384733 |
| Molecular Formula | C63H94BN2S |
| Molecular Weight | 922.34 g/mol |
| Exact Mass | 921.72 |
| IUPAC Name | — |
| SMILES | C=C/C(=C\C=C\[B]c1c(N(C(/C=C\CC(C)C)=C/CC(C)(C)C)c2cccc(NC(=C/C)/C=C(\CC(C)C)C(C)(C)CC)c2)sc2cc3c(cc12)C(C)(C)CCC3(C)C)C(C)(C)CCC(C)C |
| InChI | InChI=1S/C63H94BN2S/c1-21-47(61(15,16)35-32-45(6)7)28-26-38-64-57-53-42-54-55(63(19,20)37-36-62(54,17)18)43-56(53)67-58(57)66(51(30-24-27-44(4)5)33-34-59(10,11)12)52-31-25-29-50(41-52)65-49(22-2)40-48(39-46(8)9)60(13,14)23-3/h21-22,24-26,28-31,33,38,40-46,65H,1,23,27,32,34-37,39H2,2-20H3/b30-24-,38-26+,47-28+,48-40+,49-22+,51-33+ |
| InChIKey | ZBJNSZMDOHYRGS-IHEYUASUSA-N |
| XLogP | 19.45 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 922.34 |
| LogP ≤ 5 | 19.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|