C20H15F3N4O3S — CID 16738575
N-(4-indol-1-ylsulfonylphenyl)-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 16738575) has the molecular formula C20H15F3N4O3S and a molecular weight of 448.43 g/mol. Its IUPAC name is N-(4-indol-1-ylsulfonylphenyl)-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | N-(4-indol-1-ylsulfonylphenyl)-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 16738575 |
| Molecular Formula | C20H15F3N4O3S |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | N-(4-indol-1-ylsulfonylphenyl)-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | Cn1nc(C(F)(F)F)cc1C(=O)Nc1ccc(S(=O)(=O)n2ccc3ccccc32)cc1 |
| InChI | InChI=1S/C20H15F3N4O3S/c1-26-17(12-18(25-26)20(21,22)23)19(28)24-14-6-8-15(9-7-14)31(29,30)27-11-10-13-4-2-3-5-16(13)27/h2-12H,1H3,(H,24,28) |
| InChIKey | RSLNXBMXQOPLKD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |