About butyl-(2-methoxycarbonyl-1,3-thiazol-5-yl)tin
butyl-(2-methoxycarbonyl-1,3-thiazol-5-yl)tin (PubChem CID 167386507) has the molecular formula C9H13NO2SSn
and a molecular weight of 317.99 g/mol. Its IUPAC name is butyl-(2-methoxycarbonyl-1,3-thiazol-5-yl)tin.
Molecular Properties
| Compound Name | butyl-(2-methoxycarbonyl-1,3-thiazol-5-yl)tin |
| PubChem CID | 167386507 |
| Molecular Formula | C9H13NO2SSn |
| Molecular Weight | 317.99 g/mol |
| Exact Mass | 318.97 |
| IUPAC Name | butyl-(2-methoxycarbonyl-1,3-thiazol-5-yl)tin |
| SMILES | CCCC[Sn]c1cnc(C(=O)OC)s1 |
| InChI | InChI=1S/C5H4NO2S.C4H9.Sn/c1-8-5(7)4-6-2-3-9-4;1-3-4-2;/h2H,1H3;1,3-4H2,2H3; |
| InChIKey | QOIYWDNIOWTWGJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.99 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl-(2-methoxycarbonyl-1,3-thiazol-5-yl)tin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl-(2-methoxycarbonyl-1,3-thiazol-5-yl)tin?
The IUPAC name of butyl-(2-methoxycarbonyl-1,3-thiazol-5-yl)tin (CID 167386507) is butyl-(2-methoxycarbonyl-1,3-thiazol-5-yl)tin.
What is the SMILES notation for butyl-(2-methoxycarbonyl-1,3-thiazol-5-yl)tin?
The canonical SMILES for butyl-(2-methoxycarbonyl-1,3-thiazol-5-yl)tin is CCCC[Sn]c1cnc(C(=O)OC)s1.
What is the InChIKey of butyl-(2-methoxycarbonyl-1,3-thiazol-5-yl)tin?
The InChIKey is QOIYWDNIOWTWGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4NO2S.C4H9.Sn/c1-8-5(7)4-6-2-3-9-4;1-3-4-2;/h2H,1H3;1,3-4H2,2H3;.
What are the key properties of butyl-(2-methoxycarbonyl-1,3-thiazol-5-yl)tin?
butyl-(2-methoxycarbonyl-1,3-thiazol-5-yl)tin has a molecular weight of 317.99 g/mol, XLogP of 1.48, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl-(2-methoxycarbonyl-1,3-thiazol-5-yl)tin is sourced from PubChem (CID 167386507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).