C17H22N2O — CID 16738663
N-(2-methylpropyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxamide (PubChem CID 16738663) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is N-(2-methylpropyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxamide.
| Compound Name | N-(2-methylpropyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 16738663 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | N-(2-methylpropyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxamide |
| SMILES | CC(C)CNC(=O)C1Nc2ccccc2C2C=CCC12 |
| InChI | InChI=1S/C17H22N2O/c1-11(2)10-18-17(20)16-14-8-5-7-12(14)13-6-3-4-9-15(13)19-16/h3-7,9,11-12,14,16,19H,8,10H2,1-2H3,(H,18,20) |
| InChIKey | ADXDMWLQQWGDOX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|