C10H15FN4 — CID 167387456
(3S,4S,6S)-4-fluoro-6-(5-methylpyrazin-2-yl)piperidin-3-amine (PubChem CID 167387456) has the molecular formula C10H15FN4 and a molecular weight of 210.26 g/mol. Its IUPAC name is (3S,4S,6S)-4-fluoro-6-(5-methylpyrazin-2-yl)piperidin-3-amine.
| Compound Name | (3S,4S,6S)-4-fluoro-6-(5-methylpyrazin-2-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 167387456 |
| Molecular Formula | C10H15FN4 |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (3S,4S,6S)-4-fluoro-6-(5-methylpyrazin-2-yl)piperidin-3-amine |
| SMILES | Cc1cnc([C@@H]2C[C@H](F)[C@@H](N)CN2)cn1 |
| InChI | InChI=1S/C10H15FN4/c1-6-3-14-10(5-13-6)9-2-7(11)8(12)4-15-9/h3,5,7-9,15H,2,4,12H2,1H3/t7-,8-,9-/m0/s1 |
| InChIKey | CPTMPFNOMFSQBL-CIUDSAMLSA-N |
| XLogP | 0.48 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |