About [(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate
[(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate (PubChem CID 167387496) has the molecular formula C17H22N2O3S
and a molecular weight of 334.44 g/mol. Its IUPAC name is [(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | [(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate |
| PubChem CID | 167387496 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | [(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate |
| SMILES | CC(C)(C)C1=NOC(C)(C(=O)O/N=C2\CCCc3sccc32)C1 |
| InChI | InChI=1S/C17H22N2O3S/c1-16(2,3)14-10-17(4,22-19-14)15(20)21-18-12-6-5-7-13-11(12)8-9-23-13/h8-9H,5-7,10H2,1-4H3/b18-12+ |
| InChIKey | KNLKUEYUEKFUHS-LDADJPATSA-N |
| XLogP | 3.91 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate?
The IUPAC name of [(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate (CID 167387496) is [(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate.
What is the SMILES notation for [(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate?
The canonical SMILES for [(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate is CC(C)(C)C1=NOC(C)(C(=O)O/N=C2\CCCc3sccc32)C1.
What is the InChIKey of [(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate?
The InChIKey is KNLKUEYUEKFUHS-LDADJPATSA-N. The full InChI is InChI=1S/C17H22N2O3S/c1-16(2,3)14-10-17(4,22-19-14)15(20)21-18-12-6-5-7-13-11(12)8-9-23-13/h8-9H,5-7,10H2,1-4H3/b18-12+.
What are the key properties of [(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate?
[(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate has a molecular weight of 334.44 g/mol, XLogP of 3.91, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate is sourced from PubChem (CID 167387496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).