About [(E)-(2-chlorophenyl)methylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate
[(E)-(2-chlorophenyl)methylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate (PubChem CID 167387504) has the molecular formula C16H19ClN2O3
and a molecular weight of 322.79 g/mol. Its IUPAC name is [(E)-(2-chlorophenyl)methylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | [(E)-(2-chlorophenyl)methylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate |
| PubChem CID | 167387504 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | [(E)-(2-chlorophenyl)methylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate |
| SMILES | CC(C)(C)C1=NOC(C)(C(=O)O/N=C/c2ccccc2Cl)C1 |
| InChI | InChI=1S/C16H19ClN2O3/c1-15(2,3)13-9-16(4,22-19-13)14(20)21-18-10-11-7-5-6-8-12(11)17/h5-8,10H,9H2,1-4H3/b18-10+ |
| InChIKey | WWMWLZAOVXKORZ-VCHYOVAHSA-N |
| XLogP | 3.80 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-(2-chlorophenyl)methylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-(2-chlorophenyl)methylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate?
The IUPAC name of [(E)-(2-chlorophenyl)methylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate (CID 167387504) is [(E)-(2-chlorophenyl)methylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate.
What is the SMILES notation for [(E)-(2-chlorophenyl)methylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate?
The canonical SMILES for [(E)-(2-chlorophenyl)methylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate is CC(C)(C)C1=NOC(C)(C(=O)O/N=C/c2ccccc2Cl)C1.
What is the InChIKey of [(E)-(2-chlorophenyl)methylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate?
The InChIKey is WWMWLZAOVXKORZ-VCHYOVAHSA-N. The full InChI is InChI=1S/C16H19ClN2O3/c1-15(2,3)13-9-16(4,22-19-13)14(20)21-18-10-11-7-5-6-8-12(11)17/h5-8,10H,9H2,1-4H3/b18-10+.
What are the key properties of [(E)-(2-chlorophenyl)methylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate?
[(E)-(2-chlorophenyl)methylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate has a molecular weight of 322.79 g/mol, XLogP of 3.80, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-(2-chlorophenyl)methylideneamino] 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylate is sourced from PubChem (CID 167387504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).