About [(E)-1-phenylethylideneamino] 5-methyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate
[(E)-1-phenylethylideneamino] 5-methyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate (PubChem CID 167387532) has the molecular formula C16H20N2O3
and a molecular weight of 288.35 g/mol. Its IUPAC name is [(E)-1-phenylethylideneamino] 5-methyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | [(E)-1-phenylethylideneamino] 5-methyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate |
| PubChem CID | 167387532 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | [(E)-1-phenylethylideneamino] 5-methyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate |
| SMILES | C/C(=N\OC(=O)C1(C)CC(C(C)C)=NO1)c1ccccc1 |
| InChI | InChI=1S/C16H20N2O3/c1-11(2)14-10-16(4,21-18-14)15(19)20-17-12(3)13-8-6-5-7-9-13/h5-9,11H,10H2,1-4H3/b17-12+ |
| InChIKey | BWBPXPSFXPGSJM-SFQUDFHCSA-N |
| XLogP | 3.14 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1-phenylethylideneamino] 5-methyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1-phenylethylideneamino] 5-methyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate?
The IUPAC name of [(E)-1-phenylethylideneamino] 5-methyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate (CID 167387532) is [(E)-1-phenylethylideneamino] 5-methyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate.
What is the SMILES notation for [(E)-1-phenylethylideneamino] 5-methyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate?
The canonical SMILES for [(E)-1-phenylethylideneamino] 5-methyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate is C/C(=N\OC(=O)C1(C)CC(C(C)C)=NO1)c1ccccc1.
What is the InChIKey of [(E)-1-phenylethylideneamino] 5-methyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate?
The InChIKey is BWBPXPSFXPGSJM-SFQUDFHCSA-N. The full InChI is InChI=1S/C16H20N2O3/c1-11(2)14-10-16(4,21-18-14)15(19)20-17-12(3)13-8-6-5-7-9-13/h5-9,11H,10H2,1-4H3/b17-12+.
What are the key properties of [(E)-1-phenylethylideneamino] 5-methyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate?
[(E)-1-phenylethylideneamino] 5-methyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate has a molecular weight of 288.35 g/mol, XLogP of 3.14, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1-phenylethylideneamino] 5-methyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate is sourced from PubChem (CID 167387532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).