C28H38N2OSi — CID 167387620
N-[5,7-dimethyl-2-[4-(2-trimethylsilylethynyl)phenyl]-3,4-dihydro-1H-isoquinolin-6-yl]-3,3-dimethylbutanamide (PubChem CID 167387620) has the molecular formula C28H38N2OSi and a molecular weight of 446.71 g/mol. Its IUPAC name is N-[5,7-dimethyl-2-[4-(2-trimethylsilylethynyl)phenyl]-3,4-dihydro-1H-isoquinolin-6-yl]-3,3-dimethylbutanamide.
| Compound Name | N-[5,7-dimethyl-2-[4-(2-trimethylsilylethynyl)phenyl]-3,4-dihydro-1H-isoquinolin-6-yl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 167387620 |
| Molecular Formula | C28H38N2OSi |
| Molecular Weight | 446.71 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | N-[5,7-dimethyl-2-[4-(2-trimethylsilylethynyl)phenyl]-3,4-dihydro-1H-isoquinolin-6-yl]-3,3-dimethylbutanamide |
| SMILES | Cc1cc2c(c(C)c1NC(=O)CC(C)(C)C)CCN(c1ccc(C#C[Si](C)(C)C)cc1)C2 |
| InChI | InChI=1S/C28H38N2OSi/c1-20-17-23-19-30(24-11-9-22(10-12-24)14-16-32(6,7)8)15-13-25(23)21(2)27(20)29-26(31)18-28(3,4)5/h9-12,17H,13,15,18-19H2,1-8H3,(H,29,31) |
| InChIKey | GUTNUHOLMXXNNU-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.71 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|