C22H19BBrFN6O4 — CID 167387774
CID 167387774 (PubChem CID 167387774) has the molecular formula C22H19BBrFN6O4 and a molecular weight of 541.15 g/mol.
| Compound Name | CID 167387774 |
|---|---|
| PubChem CID | 167387774 |
| Molecular Formula | C22H19BBrFN6O4 |
| Molecular Weight | 541.15 g/mol |
| Exact Mass | 540.07 |
| IUPAC Name | — |
| SMILES | [B]c1c(C(O)c2ccnn2-c2ccc(F)cc2C(C)Oc2cc(Br)cnc2[N+](=O)[O-])cnn1CC |
| InChI | InChI=1S/C22H19BBrFN6O4/c1-3-29-21(23)16(11-28-29)20(32)18-6-7-27-30(18)17-5-4-14(25)9-15(17)12(2)35-19-8-13(24)10-26-22(19)31(33)34/h4-12,20,32H,3H2,1-2H3 |
| InChIKey | DVBQIMZRMYWQEW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.15 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|