C9H7F2INO4S- — CID 167388325
1,1-difluoro-2-[(4-iodobenzoyl)amino]ethanesulfonate (PubChem CID 167388325) has the molecular formula C9H7F2INO4S- and a molecular weight of 390.13 g/mol. Its IUPAC name is 1,1-difluoro-2-[(4-iodobenzoyl)amino]ethanesulfonate.
| Compound Name | 1,1-difluoro-2-[(4-iodobenzoyl)amino]ethanesulfonate |
|---|---|
| PubChem CID | 167388325 |
| Molecular Formula | C9H7F2INO4S- |
| Molecular Weight | 390.13 g/mol |
| Exact Mass | 389.91 |
| IUPAC Name | 1,1-difluoro-2-[(4-iodobenzoyl)amino]ethanesulfonate |
| SMILES | O=C(NCC(F)(F)S(=O)(=O)[O-])c1ccc(I)cc1 |
| InChI | InChI=1S/C9H8F2INO4S/c10-9(11,18(15,16)17)5-13-8(14)6-1-3-7(12)4-2-6/h1-4H,5H2,(H,13,14)(H,15,16,17)/p-1 |
| InChIKey | DYUQKSWTWBNMQT-UHFFFAOYSA-M |
| XLogP | 1.16 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.13 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|