C26H26FN3O3 — CID 16738888
(3Z,6R,9aS)-6-(4-fluorophenyl)-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1,6,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-4-one (PubChem CID 16738888) has the molecular formula C26H26FN3O3 and a molecular weight of 447.51 g/mol. Its IUPAC name is (3Z,6R,9aS)-6-(4-fluorophenyl)-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1,6,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-4-one.
| Compound Name | (3Z,6R,9aS)-6-(4-fluorophenyl)-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1,6,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-4-one |
|---|---|
| PubChem CID | 16738888 |
| Molecular Formula | C26H26FN3O3 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | (3Z,6R,9aS)-6-(4-fluorophenyl)-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1,6,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-4-one |
| SMILES | COc1cc(/C=C2\OC[C@@H]3CCC[C@H](c4ccc(F)cc4)N3C2=O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C26H26FN3O3/c1-17-14-29(16-28-17)23-11-6-18(12-24(23)32-2)13-25-26(31)30-21(15-33-25)4-3-5-22(30)19-7-9-20(27)10-8-19/h6-14,16,21-22H,3-5,15H2,1-2H3/b25-13-/t21-,22+/m0/s1 |
| InChIKey | PCYFATWBGYHQBI-BOLJMQTPSA-N |
| XLogP | 4.82 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|