C21H26ClN7O2 — CID 167390016
[6-(8-chloro-5-methyl-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl)-2,6-diazaspiro[3.3]heptan-2-yl]-morpholin-4-ylmethanone (PubChem CID 167390016) has the molecular formula C21H26ClN7O2 and a molecular weight of 443.94 g/mol. Its IUPAC name is [6-(8-chloro-5-methyl-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl)-2,6-diazaspiro[3.3]heptan-2-yl]-morpholin-4-ylmethanone.
| Compound Name | [6-(8-chloro-5-methyl-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl)-2,6-diazaspiro[3.3]heptan-2-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 167390016 |
| Molecular Formula | C21H26ClN7O2 |
| Molecular Weight | 443.94 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | [6-(8-chloro-5-methyl-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl)-2,6-diazaspiro[3.3]heptan-2-yl]-morpholin-4-ylmethanone |
| SMILES | CN1Cc2cc(Cl)ccc2-n2c(nnc2N2CC3(CN(C(=O)N4CCOCC4)C3)C2)C1 |
| InChI | InChI=1S/C21H26ClN7O2/c1-25-9-15-8-16(22)2-3-17(15)29-18(10-25)23-24-19(29)27-11-21(12-27)13-28(14-21)20(30)26-4-6-31-7-5-26/h2-3,8H,4-7,9-14H2,1H3 |
| InChIKey | IICATPZFUYODTI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 69.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.94 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |