C21H24ClN5O3 — CID 167390566
(2Z)-4-[8-chloro-7-(piperidine-1-carbonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]-2-(methylhydrazinylidene)pyridine-1-carbaldehyde (PubChem CID 167390566) has the molecular formula C21H24ClN5O3 and a molecular weight of 429.91 g/mol. Its IUPAC name is (2Z)-4-[8-chloro-7-(piperidine-1-carbonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]-2-(methylhydrazinylidene)pyridine-1-carbaldehyde.
| Compound Name | (2Z)-4-[8-chloro-7-(piperidine-1-carbonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]-2-(methylhydrazinylidene)pyridine-1-carbaldehyde |
|---|---|
| PubChem CID | 167390566 |
| Molecular Formula | C21H24ClN5O3 |
| Molecular Weight | 429.91 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | (2Z)-4-[8-chloro-7-(piperidine-1-carbonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]-2-(methylhydrazinylidene)pyridine-1-carbaldehyde |
| SMILES | CN/N=c1/cc(N2CCOc3c2ccc(C(=O)N2CCCCC2)c3Cl)ccn1C=O |
| InChI | InChI=1S/C21H24ClN5O3/c1-23-24-18-13-15(7-10-26(18)14-28)27-11-12-30-20-17(27)6-5-16(19(20)22)21(29)25-8-3-2-4-9-25/h5-7,10,13-14,23H,2-4,8-9,11-12H2,1H3/b24-18- |
| InChIKey | HPFXZWATIVBZSC-MOHJPFBDSA-N |
| XLogP | 2.37 |
| TPSA | 79.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.91 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|