C25H31N3O3 — CID 167390604
2-(methoxymethyl)-5-[6-(piperidine-1-carbonyl)-3,4,7,8-tetrahydro-2H-1,8-naphthyridin-1-yl]-2,3-dihydroinden-1-one (PubChem CID 167390604) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 2-(methoxymethyl)-5-[6-(piperidine-1-carbonyl)-3,4,7,8-tetrahydro-2H-1,8-naphthyridin-1-yl]-2,3-dihydroinden-1-one.
| Compound Name | 2-(methoxymethyl)-5-[6-(piperidine-1-carbonyl)-3,4,7,8-tetrahydro-2H-1,8-naphthyridin-1-yl]-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 167390604 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 2-(methoxymethyl)-5-[6-(piperidine-1-carbonyl)-3,4,7,8-tetrahydro-2H-1,8-naphthyridin-1-yl]-2,3-dihydroinden-1-one |
| SMILES | COCC1Cc2cc(N3CCCC4=C3NCC(C(=O)N3CCCCC3)=C4)ccc2C1=O |
| InChI | InChI=1S/C25H31N3O3/c1-31-16-20-13-18-14-21(7-8-22(18)23(20)29)28-11-5-6-17-12-19(15-26-24(17)28)25(30)27-9-3-2-4-10-27/h7-8,12,14,20,26H,2-6,9-11,13,15-16H2,1H3 |
| InChIKey | IJPXRBVCMSTDRM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |