C25H34N2O8 — CID 16739205
(2R,3R,4R,5S)-6-(butylamino)hexane-1,2,3,4,5-pentol;2-(9-oxoacridin-10-yl)acetic acid (PubChem CID 16739205) has the molecular formula C25H34N2O8 and a molecular weight of 490.55 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-(butylamino)hexane-1,2,3,4,5-pentol;2-(9-oxoacridin-10-yl)acetic acid.
| Compound Name | (2R,3R,4R,5S)-6-(butylamino)hexane-1,2,3,4,5-pentol;2-(9-oxoacridin-10-yl)acetic acid |
|---|---|
| PubChem CID | 16739205 |
| Molecular Formula | C25H34N2O8 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | (2R,3R,4R,5S)-6-(butylamino)hexane-1,2,3,4,5-pentol;2-(9-oxoacridin-10-yl)acetic acid |
| SMILES | CCCCNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=C(O)Cn1c2ccccc2c(=O)c2ccccc21 |
| InChI | InChI=1S/C15H11NO3.C10H23NO5/c17-14(18)9-16-12-7-3-1-5-10(12)15(19)11-6-2-4-8-13(11)16;1-2-3-4-11-5-7(13)9(15)10(16)8(14)6-12/h1-8H,9H2,(H,17,18);7-16H,2-6H2,1H3/t;7-,8+,9+,10+/m.0/s1 |
| InChIKey | LOEOGNYGLDVPDV-KFXURVLUSA-N |
| XLogP | 0.05 |
| TPSA | 172.48 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|