C11H10N4O2 — CID 16739249
3,5-dimethyl-3,5,8,13-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4,6-dione (PubChem CID 16739249) has the molecular formula C11H10N4O2 and a molecular weight of 230.23 g/mol. Its IUPAC name is 3,5-dimethyl-3,5,8,13-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4,6-dione.
| Compound Name | 3,5-dimethyl-3,5,8,13-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4,6-dione |
|---|---|
| PubChem CID | 16739249 |
| Molecular Formula | C11H10N4O2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 3,5-dimethyl-3,5,8,13-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4,6-dione |
| SMILES | Cn1c(=O)c2[nH]c3cccnc3c2n(C)c1=O |
| InChI | InChI=1S/C11H10N4O2/c1-14-9-7-6(4-3-5-12-7)13-8(9)10(16)15(2)11(14)17/h3-5,13H,1-2H3 |
| InChIKey | DTSCLFDGIVWOGR-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |