About (2R,3S)-2-aminododecan-3-ol
(2R,3S)-2-aminododecan-3-ol (PubChem CID 16739261) has the molecular formula C12H27NO
and a molecular weight of 201.35 g/mol. Its IUPAC name is (2R,3S)-2-aminododecan-3-ol.
Molecular Properties
| Compound Name | (2R,3S)-2-aminododecan-3-ol |
| PubChem CID | 16739261 |
| Molecular Formula | C12H27NO |
| Molecular Weight | 201.35 g/mol |
| Exact Mass | 201.21 |
| IUPAC Name | (2R,3S)-2-aminododecan-3-ol |
| SMILES | CCCCCCCCC[C@H](O)[C@@H](C)N |
| InChI | InChI=1S/C12H27NO/c1-3-4-5-6-7-8-9-10-12(14)11(2)13/h11-12,14H,3-10,13H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | AGYWAEBSOUKZJQ-NEPJUHHUSA-N |
| XLogP | 2.84 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2R,3S)-2-aminododecan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-2-aminododecan-3-ol?
The IUPAC name of (2R,3S)-2-aminododecan-3-ol (CID 16739261) is (2R,3S)-2-aminododecan-3-ol.
What is the SMILES notation for (2R,3S)-2-aminododecan-3-ol?
The canonical SMILES for (2R,3S)-2-aminododecan-3-ol is CCCCCCCCC[C@H](O)[C@@H](C)N.
What is the InChIKey of (2R,3S)-2-aminododecan-3-ol?
The InChIKey is AGYWAEBSOUKZJQ-NEPJUHHUSA-N. The full InChI is InChI=1S/C12H27NO/c1-3-4-5-6-7-8-9-10-12(14)11(2)13/h11-12,14H,3-10,13H2,1-2H3/t11-,12+/m1/s1.
What are the key properties of (2R,3S)-2-aminododecan-3-ol?
(2R,3S)-2-aminododecan-3-ol has a molecular weight of 201.35 g/mol, XLogP of 2.84, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-2-aminododecan-3-ol is sourced from PubChem (CID 16739261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).