C14H10F4O4S2 — CID 16739283
5,6,7,8-tetrafluoro-2,3-bis(2-hydroxyethylsulfanyl)naphthalene-1,4-dione (PubChem CID 16739283) has the molecular formula C14H10F4O4S2 and a molecular weight of 382.36 g/mol. Its IUPAC name is 5,6,7,8-tetrafluoro-2,3-bis(2-hydroxyethylsulfanyl)naphthalene-1,4-dione.
| Compound Name | 5,6,7,8-tetrafluoro-2,3-bis(2-hydroxyethylsulfanyl)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 16739283 |
| Molecular Formula | C14H10F4O4S2 |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | 5,6,7,8-tetrafluoro-2,3-bis(2-hydroxyethylsulfanyl)naphthalene-1,4-dione |
| SMILES | O=C1C(SCCO)=C(SCCO)C(=O)c2c(F)c(F)c(F)c(F)c21 |
| InChI | InChI=1S/C14H10F4O4S2/c15-7-5-6(8(16)10(18)9(7)17)12(22)14(24-4-2-20)13(11(5)21)23-3-1-19/h19-20H,1-4H2 |
| InChIKey | BHSNUJTYMFHYGW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|