C19H18N2O2 — CID 16739288
7-methyl-6-phenylmethoxy-2,3,4,9-tetrahydropyrido[3,4-b]indol-1-one (PubChem CID 16739288) has the molecular formula C19H18N2O2 and a molecular weight of 306.36 g/mol. Its IUPAC name is 7-methyl-6-phenylmethoxy-2,3,4,9-tetrahydropyrido[3,4-b]indol-1-one.
| Compound Name | 7-methyl-6-phenylmethoxy-2,3,4,9-tetrahydropyrido[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 16739288 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 7-methyl-6-phenylmethoxy-2,3,4,9-tetrahydropyrido[3,4-b]indol-1-one |
| SMILES | Cc1cc2[nH]c3c(c2cc1OCc1ccccc1)CCNC3=O |
| InChI | InChI=1S/C19H18N2O2/c1-12-9-16-15(14-7-8-20-19(22)18(14)21-16)10-17(12)23-11-13-5-3-2-4-6-13/h2-6,9-10,21H,7-8,11H2,1H3,(H,20,22) |
| InChIKey | DYTMNPUOZGPWQA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|