About 2-hydroxypropyl nitrite
2-hydroxypropyl nitrite (PubChem CID 16739326) has the molecular formula C3H7NO3
and a molecular weight of 105.09 g/mol. Its IUPAC name is 2-hydroxypropyl nitrite.
Molecular Properties
| Compound Name | 2-hydroxypropyl nitrite |
| PubChem CID | 16739326 |
| Molecular Formula | C3H7NO3 |
| Molecular Weight | 105.09 g/mol |
| Exact Mass | 105.04 |
| IUPAC Name | 2-hydroxypropyl nitrite |
| SMILES | CC(O)CON=O |
| InChI | InChI=1S/C3H7NO3/c1-3(5)2-7-4-6/h3,5H,2H2,1H3 |
| InChIKey | KZMYCIZNYWKOFQ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.09 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypropyl nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropyl nitrite?
The IUPAC name of 2-hydroxypropyl nitrite (CID 16739326) is 2-hydroxypropyl nitrite.
What is the SMILES notation for 2-hydroxypropyl nitrite?
The canonical SMILES for 2-hydroxypropyl nitrite is CC(O)CON=O.
What is the InChIKey of 2-hydroxypropyl nitrite?
The InChIKey is KZMYCIZNYWKOFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO3/c1-3(5)2-7-4-6/h3,5H,2H2,1H3.
What are the key properties of 2-hydroxypropyl nitrite?
2-hydroxypropyl nitrite has a molecular weight of 105.09 g/mol, XLogP of 0.07, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropyl nitrite is sourced from PubChem (CID 16739326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).