C28H44O3 — CID 16739341
methyl (2R)-2-[(5S,10R,13S,17R)-10,13-dimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-6-methylheptanoate (PubChem CID 16739341) has the molecular formula C28H44O3 and a molecular weight of 428.66 g/mol. Its IUPAC name is methyl (2R)-2-[(5S,10R,13S,17R)-10,13-dimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-6-methylheptanoate.
| Compound Name | methyl (2R)-2-[(5S,10R,13S,17R)-10,13-dimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-6-methylheptanoate |
|---|---|
| PubChem CID | 16739341 |
| Molecular Formula | C28H44O3 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | methyl (2R)-2-[(5S,10R,13S,17R)-10,13-dimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-6-methylheptanoate |
| SMILES | COC(=O)[C@H](CCCC(C)C)[C@H]1CCC2C3CC[C@H]4CC(=O)C=C[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C28H44O3/c1-18(2)7-6-8-22(26(30)31-5)24-12-11-23-21-10-9-19-17-20(29)13-15-27(19,3)25(21)14-16-28(23,24)4/h13,15,18-19,21-25H,6-12,14,16-17H2,1-5H3/t19-,21?,22+,23?,24+,25?,27-,28-/m0/s1 |
| InChIKey | LTTLIRHGLXHJJP-BWARMTIOSA-N |
| XLogP | 6.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |