C21H22N4O2 — CID 16739464
(9E)-12-methyl-7,26-dioxa-12,19,21,24-tetrazatetracyclo[18.3.1.12,5.114,18]hexacosa-1(24),2,4,9,14(25),15,17,20,22-nonaene (PubChem CID 16739464) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is (9E)-12-methyl-7,26-dioxa-12,19,21,24-tetrazatetracyclo[18.3.1.12,5.114,18]hexacosa-1(24),2,4,9,14(25),15,17,20,22-nonaene.
| Compound Name | (9E)-12-methyl-7,26-dioxa-12,19,21,24-tetrazatetracyclo[18.3.1.12,5.114,18]hexacosa-1(24),2,4,9,14(25),15,17,20,22-nonaene |
|---|---|
| PubChem CID | 16739464 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (9E)-12-methyl-7,26-dioxa-12,19,21,24-tetrazatetracyclo[18.3.1.12,5.114,18]hexacosa-1(24),2,4,9,14(25),15,17,20,22-nonaene |
| SMILES | CN1C/C=C\COCc2ccc(o2)-c2ccnc(n2)Nc2cccc(c2)C1 |
| InChI | InChI=1S/C21H22N4O2/c1-25-11-2-3-12-26-15-18-7-8-20(27-18)19-9-10-22-21(24-19)23-17-6-4-5-16(13-17)14-25/h2-10,13H,11-12,14-15H2,1H3,(H,22,23,24)/b3-2- |
| InChIKey | NAMNDYOCPPYNFK-IHWYPQMZSA-N |
| XLogP | 4.00 |
| TPSA | 63.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|