C24H23F3N4O2 — CID 16739512
(16E)-14-methyl-11-(trifluoromethoxy)-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene (PubChem CID 16739512) has the molecular formula C24H23F3N4O2 and a molecular weight of 456.47 g/mol. Its IUPAC name is (16E)-14-methyl-11-(trifluoromethoxy)-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene.
| Compound Name | (16E)-14-methyl-11-(trifluoromethoxy)-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene |
|---|---|
| PubChem CID | 16739512 |
| Molecular Formula | C24H23F3N4O2 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | (16E)-14-methyl-11-(trifluoromethoxy)-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene |
| SMILES | CN1C/C=C\CCOc2cccc(c2)-c2ccnc(n2)Nc2ccc(OC(F)(F)F)c(c2)C1 |
| InChI | InChI=1S/C24H23F3N4O2/c1-31-12-3-2-4-13-32-20-7-5-6-17(15-20)21-10-11-28-23(30-21)29-19-8-9-22(18(14-19)16-31)33-24(25,26)27/h2-3,5-11,14-15H,4,12-13,16H2,1H3,(H,28,29,30)/b3-2- |
| InChIKey | KPEWGEQNXTXESG-IHWYPQMZSA-N |
| XLogP | 5.56 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|