About (3E)-3-(1,1,1-trifluoropropan-2-ylidene)pyrrolidine;hydrochloride
(3E)-3-(1,1,1-trifluoropropan-2-ylidene)pyrrolidine;hydrochloride (PubChem CID 167395794) has the molecular formula C7H11ClF3N
and a molecular weight of 201.62 g/mol. Its IUPAC name is (3E)-3-(1,1,1-trifluoropropan-2-ylidene)pyrrolidine;hydrochloride.
Molecular Properties
| Compound Name | (3E)-3-(1,1,1-trifluoropropan-2-ylidene)pyrrolidine;hydrochloride |
| PubChem CID | 167395794 |
| Molecular Formula | C7H11ClF3N |
| Molecular Weight | 201.62 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | (3E)-3-(1,1,1-trifluoropropan-2-ylidene)pyrrolidine;hydrochloride |
| SMILES | C/C(=C1/CCNC1)C(F)(F)F.Cl |
| InChI | InChI=1S/C7H10F3N.ClH/c1-5(7(8,9)10)6-2-3-11-4-6;/h11H,2-4H2,1H3;1H/b6-5+; |
| InChIKey | WLHHRNLRPYDHRN-IPZCTEOASA-N |
| XLogP | 2.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.62 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-(1,1,1-trifluoropropan-2-ylidene)pyrrolidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-(1,1,1-trifluoropropan-2-ylidene)pyrrolidine;hydrochloride?
The IUPAC name of (3E)-3-(1,1,1-trifluoropropan-2-ylidene)pyrrolidine;hydrochloride (CID 167395794) is (3E)-3-(1,1,1-trifluoropropan-2-ylidene)pyrrolidine;hydrochloride.
What is the SMILES notation for (3E)-3-(1,1,1-trifluoropropan-2-ylidene)pyrrolidine;hydrochloride?
The canonical SMILES for (3E)-3-(1,1,1-trifluoropropan-2-ylidene)pyrrolidine;hydrochloride is C/C(=C1/CCNC1)C(F)(F)F.Cl.
What is the InChIKey of (3E)-3-(1,1,1-trifluoropropan-2-ylidene)pyrrolidine;hydrochloride?
The InChIKey is WLHHRNLRPYDHRN-IPZCTEOASA-N. The full InChI is InChI=1S/C7H10F3N.ClH/c1-5(7(8,9)10)6-2-3-11-4-6;/h11H,2-4H2,1H3;1H/b6-5+;.
What are the key properties of (3E)-3-(1,1,1-trifluoropropan-2-ylidene)pyrrolidine;hydrochloride?
(3E)-3-(1,1,1-trifluoropropan-2-ylidene)pyrrolidine;hydrochloride has a molecular weight of 201.62 g/mol, XLogP of 2.28, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-(1,1,1-trifluoropropan-2-ylidene)pyrrolidine;hydrochloride is sourced from PubChem (CID 167395794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).