C26H30N4O — CID 16739709
(16E)-14-(2-methylpropyl)-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaene (PubChem CID 16739709) has the molecular formula C26H30N4O and a molecular weight of 414.55 g/mol. Its IUPAC name is (16E)-14-(2-methylpropyl)-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaene.
| Compound Name | (16E)-14-(2-methylpropyl)-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaene |
|---|---|
| PubChem CID | 16739709 |
| Molecular Formula | C26H30N4O |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | (16E)-14-(2-methylpropyl)-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaene |
| SMILES | CC(C)CN1C/C=C\CCOc2cccc(c2)-c2ccnc(n2)Nc2cccc(c2)C1 |
| InChI | InChI=1S/C26H30N4O/c1-20(2)18-30-14-4-3-5-15-31-24-11-7-9-22(17-24)25-12-13-27-26(29-25)28-23-10-6-8-21(16-23)19-30/h3-4,6-13,16-17,20H,5,14-15,18-19H2,1-2H3,(H,27,28,29)/b4-3- |
| InChIKey | MUPFBXXZGZFXEZ-ARJAWSKDSA-N |
| XLogP | 5.68 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|