C39H44N6O4 — CID 16739765
N-[4-[4-(diethylaminocarbamoylamino)phenoxy]-3-methylphenyl]-4-[3-[(4-hydroxypiperidin-1-yl)methyl]indol-1-yl]benzamide (PubChem CID 16739765) has the molecular formula C39H44N6O4 and a molecular weight of 660.82 g/mol. Its IUPAC name is N-[4-[4-(diethylaminocarbamoylamino)phenoxy]-3-methylphenyl]-4-[3-[(4-hydroxypiperidin-1-yl)methyl]indol-1-yl]benzamide.
| Compound Name | N-[4-[4-(diethylaminocarbamoylamino)phenoxy]-3-methylphenyl]-4-[3-[(4-hydroxypiperidin-1-yl)methyl]indol-1-yl]benzamide |
|---|---|
| PubChem CID | 16739765 |
| Molecular Formula | C39H44N6O4 |
| Molecular Weight | 660.82 g/mol |
| Exact Mass | 660.34 |
| IUPAC Name | N-[4-[4-(diethylaminocarbamoylamino)phenoxy]-3-methylphenyl]-4-[3-[(4-hydroxypiperidin-1-yl)methyl]indol-1-yl]benzamide |
| SMILES | CCN(CC)NC(=O)Nc1ccc(Oc2ccc(NC(=O)c3ccc(-n4cc(CN5CCC(O)CC5)c5ccccc54)cc3)cc2C)cc1 |
| InChI | InChI=1S/C39H44N6O4/c1-4-44(5-2)42-39(48)41-30-12-17-34(18-13-30)49-37-19-14-31(24-27(37)3)40-38(47)28-10-15-32(16-11-28)45-26-29(35-8-6-7-9-36(35)45)25-43-22-20-33(46)21-23-43/h6-19,24,26,33,46H,4-5,20-23,25H2,1-3H3,(H,40,47)(H2,41,42,48) |
| InChIKey | VTISBDCCAFXCAT-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.82 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|