C13H15N5O — CID 167397901
1-cyano-N,N-dimethyl-2-oxo-3,5-dihydro-1,4-benzodiazepine-4-carboximidamide (PubChem CID 167397901) has the molecular formula C13H15N5O and a molecular weight of 257.30 g/mol. Its IUPAC name is 1-cyano-N,N-dimethyl-2-oxo-3,5-dihydro-1,4-benzodiazepine-4-carboximidamide.
| Compound Name | 1-cyano-N,N-dimethyl-2-oxo-3,5-dihydro-1,4-benzodiazepine-4-carboximidamide |
|---|---|
| PubChem CID | 167397901 |
| Molecular Formula | C13H15N5O |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 1-cyano-N,N-dimethyl-2-oxo-3,5-dihydro-1,4-benzodiazepine-4-carboximidamide |
| SMILES | [H]/N=C(\N(C)C)N1CC(=O)N(C#N)c2ccccc2C1 |
| InChI | InChI=1S/C13H15N5O/c1-16(2)13(15)17-7-10-5-3-4-6-11(10)18(9-14)12(19)8-17/h3-6,15H,7-8H2,1-2H3/b15-13+ |
| InChIKey | HIFDERZGZBMKAH-FYWRMAATSA-N |
| XLogP | 0.81 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|